cinacalcet
SMILES | C[C@H](c1cccc2c1cccc2)NCCCc1cccc(c1)C(F)(F)F |
InChIKey | VDHAWDNDOKGFTD-MRXNPFEDSA-N |
Chemical properties
Hydrogen bond acceptors | 1 |
Hydrogen bond donors | 1 |
Rotatable bonds | 6 |
Molecular weight (Da) | 357.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 4.35 | 4.35 | 4.35 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 8.36 | 8.36 | 8.36 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CaS | CASR | Human | Calcium-sensing | C | pKB | 5.9 | 6.25 | 6.6 | Guide to Pharmacology |
CaS | CASR | Human | Calcium-sensing | C | pEC50 | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
CaS | CASR | Human | Calcium-sensing | C | pEC50 | 6.75 | 7.18 | 7.7 | ChEMBL |
CaS | CASR | Human | Calcium-sensing | C | pEC50 | 8.11 | 8.11 | 8.11 | Drug Central |