andrographolide
SMILES | OC[C@]1(C)[C@H](O)CC[C@@]2([C@@H]1CCC(=C)[C@H]2C/C=C/1\[C@H](O)COC1=O)C |
InChIKey | BOJKULTULYSRAS-OTESTREVSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 3 |
Rotatable bonds | 3 |
Molecular weight (Da) | 350.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TAS2R46 | T2R46 | Human | Taste 2 | T | pEC50 | 4.89 | 4.89 | 4.89 | Guide to Pharmacology |
TAS2R50 | T2R50 | Human | Taste 2 | T | pEC50 | 4.64 | 4.64 | 4.64 | Guide to Pharmacology |
TAS2R8 | TA2R8 | Human | Taste 2 | T | pEC50 | 3.96 | 3.96 | 3.96 | Guide to Pharmacology |