Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
11337 | 2883 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | 440 | 4 | 0 | 4 | 3.9 | O=c1c2CN(CCc2n2c(=NCC2)n1Cc1ccc(cc1)C(F)(F)F)Cc1ccccc1 | 31127149 | ||
124085867 | 2883 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | 440 | 4 | 0 | 4 | 3.9 | O=c1c2CN(CCc2n2c(=NCC2)n1Cc1ccc(cc1)C(F)(F)F)Cc1ccccc1 | 31127149 | ||
5312830 | 187 | 0 | None | - | 1 | Human | 5.7 | pEC50 | = | 5.7 | Functional | Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
5567 | 187 | 0 | None | - | 1 | Human | 5.7 | pEC50 | = | 5.7 | Functional | Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
CHEMBL1230670 | 187 | 0 | None | - | 1 | Human | 5.7 | pEC50 | = | 5.7 | Functional | Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
DB07302 | 187 | 0 | None | - | 1 | Human | 5.7 | pEC50 | = | 5.7 | Functional | Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
12945 | 2825 | 0 | None | - | 1 | Human | 7.3 | pEC50 | = | 7.3 | Functional | Guide to Pharmacology | 351 | 6 | 2 | 4 | 4.0 | CC1=C(OC2=C1C=C(NC(=O)CCC(=O)C3=CC=CC=C3)C=C2)C(O)=O | 37770763 | ||
12944 | 2824 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Functional | Guide to Pharmacology | 359 | 6 | 2 | 4 | 3.0 | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(O)=O | 37770763 | ||
4319354 | 2824 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Functional | Guide to Pharmacology | 359 | 6 | 2 | 4 | 3.0 | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(O)=O | 37770763 |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |